C29H38N4O6S — CID 129082759
tert-butyl N-[(2R)-3-methyl-1-[[3-(4-nitrophenyl)-1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl]amino]-1-oxo-3-sulfanylbutan-2-yl]carbamate (PubChem CID 129082759) has the molecular formula C29H38N4O6S and a molecular weight of 570.71 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-methyl-1-[[3-(4-nitrophenyl)-1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl]amino]-1-oxo-3-sulfanylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-methyl-1-[[3-(4-nitrophenyl)-1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl]amino]-1-oxo-3-sulfanylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 129082759 |
| Molecular Formula | C29H38N4O6S |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | tert-butyl N-[(2R)-3-methyl-1-[[3-(4-nitrophenyl)-1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl]amino]-1-oxo-3-sulfanylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)NC(Cc1ccc([N+](=O)[O-])cc1)C(=O)NC1CCCc2ccccc21)C(C)(C)S |
| InChI | InChI=1S/C29H38N4O6S/c1-28(2,3)39-27(36)32-24(29(4,5)40)26(35)31-23(17-18-13-15-20(16-14-18)33(37)38)25(34)30-22-12-8-10-19-9-6-7-11-21(19)22/h6-7,9,11,13-16,22-24,40H,8,10,12,17H2,1-5H3,(H,30,34)(H,31,35)(H,32,36)/t22?,23?,24-/m1/s1 |
| InChIKey | MBSKHQZUNQAVEZ-KXTRFFEISA-N |
| XLogP | 4.42 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|