C26H41N3O7 — CID 90201975
tert-butyl N-[(2S)-1-[[5,5-dimethoxy-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]pentan-2-yl]amino]-4-hydroxy-1-oxobutan-2-yl]carbamate (PubChem CID 90201975) has the molecular formula C26H41N3O7 and a molecular weight of 507.63 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[5,5-dimethoxy-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]pentan-2-yl]amino]-4-hydroxy-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[5,5-dimethoxy-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]pentan-2-yl]amino]-4-hydroxy-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 90201975 |
| Molecular Formula | C26H41N3O7 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[5,5-dimethoxy-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]pentan-2-yl]amino]-4-hydroxy-1-oxobutan-2-yl]carbamate |
| SMILES | COC(CCC(NC(=O)[C@H](CCO)NC(=O)OC(C)(C)C)C(=O)N[C@@H]1CCCc2ccccc21)OC |
| InChI | InChI=1S/C26H41N3O7/c1-26(2,3)36-25(33)29-21(15-16-30)24(32)28-20(13-14-22(34-4)35-5)23(31)27-19-12-8-10-17-9-6-7-11-18(17)19/h6-7,9,11,19-22,30H,8,10,12-16H2,1-5H3,(H,27,31)(H,28,32)(H,29,33)/t19-,20?,21+/m1/s1 |
| InChIKey | LXQPHCPGCGCLQR-TYVLQRECSA-N |
| XLogP | 2.34 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|