C28H34N4O6S — CID 118497959
methyl 2-[3-amino-2-methyl-4-[7-nitro-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-4-oxobutan-2-yl]sulfanylacetate (PubChem CID 118497959) has the molecular formula C28H34N4O6S and a molecular weight of 554.67 g/mol. Its IUPAC name is methyl 2-[3-amino-2-methyl-4-[7-nitro-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-4-oxobutan-2-yl]sulfanylacetate.
| Compound Name | methyl 2-[3-amino-2-methyl-4-[7-nitro-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-4-oxobutan-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 118497959 |
| Molecular Formula | C28H34N4O6S |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | methyl 2-[3-amino-2-methyl-4-[7-nitro-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-4-oxobutan-2-yl]sulfanylacetate |
| SMILES | COC(=O)CSC(C)(C)C(N)C(=O)N1Cc2cc([N+](=O)[O-])ccc2CC1C(=O)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C28H34N4O6S/c1-28(2,39-16-24(33)38-3)25(29)27(35)31-15-19-13-20(32(36)37)12-11-18(19)14-23(31)26(34)30-22-10-6-8-17-7-4-5-9-21(17)22/h4-5,7,9,11-13,22-23,25H,6,8,10,14-16,29H2,1-3H3,(H,30,34)/t22-,23?,25?/m1/s1 |
| InChIKey | QXMMCGJUKFNTQK-BJYSPHJKSA-N |
| XLogP | 3.05 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|