C27H33N3O5 — CID 175346924
[1-[7-hydroxy-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-3,3-dimethyl-1-oxobutan-2-yl] carbamate (PubChem CID 175346924) has the molecular formula C27H33N3O5 and a molecular weight of 479.58 g/mol. Its IUPAC name is [1-[7-hydroxy-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-3,3-dimethyl-1-oxobutan-2-yl] carbamate.
| Compound Name | [1-[7-hydroxy-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-3,3-dimethyl-1-oxobutan-2-yl] carbamate |
|---|---|
| PubChem CID | 175346924 |
| Molecular Formula | C27H33N3O5 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | [1-[7-hydroxy-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-3,4-dihydro-1H-isoquinolin-2-yl]-3,3-dimethyl-1-oxobutan-2-yl] carbamate |
| SMILES | CC(C)(C)C(OC(N)=O)C(=O)N1Cc2cc(O)ccc2CC1C(=O)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C27H33N3O5/c1-27(2,3)23(35-26(28)34)25(33)30-15-18-13-19(31)12-11-17(18)14-22(30)24(32)29-21-10-6-8-16-7-4-5-9-20(16)21/h4-5,7,9,11-13,21-23,31H,6,8,10,14-15H2,1-3H3,(H2,28,34)(H,29,32)/t21-,22?,23?/m1/s1 |
| InChIKey | PXFBIKFGWJRSOA-DDRJZQQSSA-N |
| XLogP | 3.35 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |