C32H44N4O4 — CID 168946205
2-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-7-ethoxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 168946205) has the molecular formula C32H44N4O4 and a molecular weight of 548.73 g/mol. Its IUPAC name is 2-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-7-ethoxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | 2-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-7-ethoxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 168946205 |
| Molecular Formula | C32H44N4O4 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | 2-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-7-ethoxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CCOc1ccc2c(c1)CN(C(=O)C(NC(=O)C(C)NC)C(C)(C)C)C(C(=O)NC1CCCc3ccccc31)C2 |
| InChI | InChI=1S/C32H44N4O4/c1-7-40-24-16-15-22-18-27(30(38)34-26-14-10-12-21-11-8-9-13-25(21)26)36(19-23(22)17-24)31(39)28(32(3,4)5)35-29(37)20(2)33-6/h8-9,11,13,15-17,20,26-28,33H,7,10,12,14,18-19H2,1-6H3,(H,34,38)(H,35,37) |
| InChIKey | YQUAILWIOWQLOH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |