C34H47N3O4 — CID 157398558
(3S)-2-[(2S)-3,3-dimethyl-2-[[(2R)-2-methylbutanoyl]amino]butanoyl]-7-propan-2-yloxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 157398558) has the molecular formula C34H47N3O4 and a molecular weight of 561.77 g/mol. Its IUPAC name is (3S)-2-[(2S)-3,3-dimethyl-2-[[(2R)-2-methylbutanoyl]amino]butanoyl]-7-propan-2-yloxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-2-[(2S)-3,3-dimethyl-2-[[(2R)-2-methylbutanoyl]amino]butanoyl]-7-propan-2-yloxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 157398558 |
| Molecular Formula | C34H47N3O4 |
| Molecular Weight | 561.77 g/mol |
| Exact Mass | 561.36 |
| IUPAC Name | (3S)-2-[(2S)-3,3-dimethyl-2-[[(2R)-2-methylbutanoyl]amino]butanoyl]-7-propan-2-yloxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CC[C@@H](C)C(=O)N[C@H](C(=O)N1Cc2cc(OC(C)C)ccc2C[C@H]1C(=O)NC1CCCc2ccccc21)C(C)(C)C |
| InChI | InChI=1S/C34H47N3O4/c1-8-22(4)31(38)36-30(34(5,6)7)33(40)37-20-25-18-26(41-21(2)3)17-16-24(25)19-29(37)32(39)35-28-15-11-13-23-12-9-10-14-27(23)28/h9-10,12,14,16-18,21-22,28-30H,8,11,13,15,19-20H2,1-7H3,(H,35,39)(H,36,38)/t22-,28?,29+,30-/m1/s1 |
| InChIKey | BMWJKQIENCGRSL-AKBNCAKDSA-N |
| XLogP | 5.50 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.77 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |