C32H43N3O4 — CID 167637352
2-[(2S)-3,3-dimethyl-2-[[(2R)-2-methylbutanoyl]amino]butanoyl]-7-methoxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 167637352) has the molecular formula C32H43N3O4 and a molecular weight of 533.71 g/mol. Its IUPAC name is 2-[(2S)-3,3-dimethyl-2-[[(2R)-2-methylbutanoyl]amino]butanoyl]-7-methoxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | 2-[(2S)-3,3-dimethyl-2-[[(2R)-2-methylbutanoyl]amino]butanoyl]-7-methoxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 167637352 |
| Molecular Formula | C32H43N3O4 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.33 |
| IUPAC Name | 2-[(2S)-3,3-dimethyl-2-[[(2R)-2-methylbutanoyl]amino]butanoyl]-7-methoxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CC[C@@H](C)C(=O)N[C@H](C(=O)N1Cc2cc(OC)ccc2CC1C(=O)NC1CCCc2ccccc21)C(C)(C)C |
| InChI | InChI=1S/C32H43N3O4/c1-7-20(2)29(36)34-28(32(3,4)5)31(38)35-19-23-17-24(39-6)16-15-22(23)18-27(35)30(37)33-26-14-10-12-21-11-8-9-13-25(21)26/h8-9,11,13,15-17,20,26-28H,7,10,12,14,18-19H2,1-6H3,(H,33,37)(H,34,36)/t20-,26?,27?,28-/m1/s1 |
| InChIKey | CIDOUPKGWAGROO-RUAXVTNFSA-N |
| XLogP | 4.72 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |