C31H44N4O4 — CID 168945717
2-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-N-(1,2,3,4,5,6-hexahydronaphthalen-1-yl)-7-methoxy-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 168945717) has the molecular formula C31H44N4O4 and a molecular weight of 536.72 g/mol. Its IUPAC name is 2-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-N-(1,2,3,4,5,6-hexahydronaphthalen-1-yl)-7-methoxy-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | 2-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-N-(1,2,3,4,5,6-hexahydronaphthalen-1-yl)-7-methoxy-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 168945717 |
| Molecular Formula | C31H44N4O4 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | 2-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-N-(1,2,3,4,5,6-hexahydronaphthalen-1-yl)-7-methoxy-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CNC(C)C(=O)NC(C(=O)N1Cc2cc(OC)ccc2CC1C(=O)NC1CCCC2=C1C=CCC2)C(C)(C)C |
| InChI | InChI=1S/C31H44N4O4/c1-19(32-5)28(36)34-27(31(2,3)4)30(38)35-18-22-16-23(39-6)15-14-21(22)17-26(35)29(37)33-25-13-9-11-20-10-7-8-12-24(20)25/h8,12,14-16,19,25-27,32H,7,9-11,13,17-18H2,1-6H3,(H,33,37)(H,34,36) |
| InChIKey | IQPBDAKNHTVTCJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |