C30H39N5O4 — CID 126517268
2-[3,3-dimethyl-2-[[2-(methylamino)acetyl]amino]butanoyl]-7-formamido-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 126517268) has the molecular formula C30H39N5O4 and a molecular weight of 533.67 g/mol. Its IUPAC name is 2-[3,3-dimethyl-2-[[2-(methylamino)acetyl]amino]butanoyl]-7-formamido-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | 2-[3,3-dimethyl-2-[[2-(methylamino)acetyl]amino]butanoyl]-7-formamido-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 126517268 |
| Molecular Formula | C30H39N5O4 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | 2-[3,3-dimethyl-2-[[2-(methylamino)acetyl]amino]butanoyl]-7-formamido-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CNCC(=O)NC(C(=O)N1Cc2cc(NC=O)ccc2CC1C(=O)NC1CCCc2ccccc21)C(C)(C)C |
| InChI | InChI=1S/C30H39N5O4/c1-30(2,3)27(34-26(37)16-31-4)29(39)35-17-21-14-22(32-18-36)13-12-20(21)15-25(35)28(38)33-24-11-7-9-19-8-5-6-10-23(19)24/h5-6,8,10,12-14,18,24-25,27,31H,7,9,11,15-17H2,1-4H3,(H,32,36)(H,33,38)(H,34,37) |
| InChIKey | ABVQJUSBEJMMFY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|