C38H46N4O4 — CID 155584690
2-[2-cyclohexyl-2-[[2-(methylamino)acetyl]amino]acetyl]-7-phenylmethoxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 155584690) has the molecular formula C38H46N4O4 and a molecular weight of 622.81 g/mol. Its IUPAC name is 2-[2-cyclohexyl-2-[[2-(methylamino)acetyl]amino]acetyl]-7-phenylmethoxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | 2-[2-cyclohexyl-2-[[2-(methylamino)acetyl]amino]acetyl]-7-phenylmethoxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 155584690 |
| Molecular Formula | C38H46N4O4 |
| Molecular Weight | 622.81 g/mol |
| Exact Mass | 622.35 |
| IUPAC Name | 2-[2-cyclohexyl-2-[[2-(methylamino)acetyl]amino]acetyl]-7-phenylmethoxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CNCC(=O)NC(C(=O)N1Cc2cc(OCc3ccccc3)ccc2CC1C(=O)NC1CCCc2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C38H46N4O4/c1-39-23-35(43)41-36(28-14-6-3-7-15-28)38(45)42-24-30-21-31(46-25-26-11-4-2-5-12-26)20-19-29(30)22-34(42)37(44)40-33-18-10-16-27-13-8-9-17-32(27)33/h2,4-5,8-9,11-13,17,19-21,28,33-34,36,39H,3,6-7,10,14-16,18,22-25H2,1H3,(H,40,44)(H,41,43) |
| InChIKey | PMUSYXANWFLIJK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.81 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |