C28H29Cl2N3O6 — CID 22223605
(4E)-4-[(3,4-dichlorophenyl)methoxyimino]-N-(furan-2-ylmethyl)-1-(2-oxo-6-pentylpyran-3-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 22223605) has the molecular formula C28H29Cl2N3O6 and a molecular weight of 574.46 g/mol. Its IUPAC name is (4E)-4-[(3,4-dichlorophenyl)methoxyimino]-N-(furan-2-ylmethyl)-1-(2-oxo-6-pentylpyran-3-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (4E)-4-[(3,4-dichlorophenyl)methoxyimino]-N-(furan-2-ylmethyl)-1-(2-oxo-6-pentylpyran-3-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 22223605 |
| Molecular Formula | C28H29Cl2N3O6 |
| Molecular Weight | 574.46 g/mol |
| Exact Mass | 573.14 |
| IUPAC Name | (4E)-4-[(3,4-dichlorophenyl)methoxyimino]-N-(furan-2-ylmethyl)-1-(2-oxo-6-pentylpyran-3-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | CCCCCc1ccc(C(=O)N2C/C(=N/OCc3ccc(Cl)c(Cl)c3)CC2C(=O)NCc2ccco2)c(=O)o1 |
| InChI | InChI=1S/C28H29Cl2N3O6/c1-2-3-4-6-20-9-10-22(28(36)39-20)27(35)33-16-19(32-38-17-18-8-11-23(29)24(30)13-18)14-25(33)26(34)31-15-21-7-5-12-37-21/h5,7-13,25H,2-4,6,14-17H2,1H3,(H,31,34)/b32-19+ |
| InChIKey | XQJBXDKPHFABSM-BIZUNTBRSA-N |
| XLogP | 5.38 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|