C20H19Cl2N3O4 — CID 131726365
(2S)-4-[(3,4-dichlorophenyl)methoxyimino]-N-(furan-2-ylmethyl)-1-prop-2-enoylpyrrolidine-2-carboxamide (PubChem CID 131726365) has the molecular formula C20H19Cl2N3O4 and a molecular weight of 436.30 g/mol. Its IUPAC name is (2S)-4-[(3,4-dichlorophenyl)methoxyimino]-N-(furan-2-ylmethyl)-1-prop-2-enoylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-4-[(3,4-dichlorophenyl)methoxyimino]-N-(furan-2-ylmethyl)-1-prop-2-enoylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 131726365 |
| Molecular Formula | C20H19Cl2N3O4 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | (2S)-4-[(3,4-dichlorophenyl)methoxyimino]-N-(furan-2-ylmethyl)-1-prop-2-enoylpyrrolidine-2-carboxamide |
| SMILES | C=CC(=O)N1CC(=NOCc2ccc(Cl)c(Cl)c2)C[C@H]1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C20H19Cl2N3O4/c1-2-19(26)25-11-14(24-29-12-13-5-6-16(21)17(22)8-13)9-18(25)20(27)23-10-15-4-3-7-28-15/h2-8,18H,1,9-12H2,(H,23,27)/t18-/m0/s1 |
| InChIKey | KZFNNHXVXRCJBT-SFHVURJKSA-N |
| XLogP | 3.56 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|