C22H27N3O6 — CID 87752541
(2S,4E)-N-(furan-2-ylmethyl)-4-methoxyimino-1-(2-oxo-6-pentylpyran-3-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 87752541) has the molecular formula C22H27N3O6 and a molecular weight of 429.47 g/mol. Its IUPAC name is (2S,4E)-N-(furan-2-ylmethyl)-4-methoxyimino-1-(2-oxo-6-pentylpyran-3-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4E)-N-(furan-2-ylmethyl)-4-methoxyimino-1-(2-oxo-6-pentylpyran-3-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 87752541 |
| Molecular Formula | C22H27N3O6 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (2S,4E)-N-(furan-2-ylmethyl)-4-methoxyimino-1-(2-oxo-6-pentylpyran-3-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | CCCCCc1ccc(C(=O)N2C/C(=N/OC)C[C@H]2C(=O)NCc2ccco2)c(=O)o1 |
| InChI | InChI=1S/C22H27N3O6/c1-3-4-5-7-16-9-10-18(22(28)31-16)21(27)25-14-15(24-29-2)12-19(25)20(26)23-13-17-8-6-11-30-17/h6,8-11,19H,3-5,7,12-14H2,1-2H3,(H,23,26)/b24-15+/t19-/m0/s1 |
| InChIKey | KNSJHMQVMVOGCT-WWJLXRQJSA-N |
| XLogP | 2.50 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|