C12H19NO3 — CID 67843167
hexyl N-(furan-2-ylmethyl)carbamate (PubChem CID 67843167) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is hexyl N-(furan-2-ylmethyl)carbamate.
| Compound Name | hexyl N-(furan-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 67843167 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | hexyl N-(furan-2-ylmethyl)carbamate |
| SMILES | CCCCCCOC(=O)NCc1ccco1 |
| InChI | InChI=1S/C12H19NO3/c1-2-3-4-5-8-16-12(14)13-10-11-7-6-9-15-11/h6-7,9H,2-5,8,10H2,1H3,(H,13,14) |
| InChIKey | VWLKGLOCIHUODQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|