C28H42O5 — CID 174741403
2-octoxycarbonylbenzoic acid;2-octylfuran (PubChem CID 174741403) has the molecular formula C28H42O5 and a molecular weight of 458.64 g/mol. Its IUPAC name is 2-octoxycarbonylbenzoic acid;2-octylfuran.
| Compound Name | 2-octoxycarbonylbenzoic acid;2-octylfuran |
|---|---|
| PubChem CID | 174741403 |
| Molecular Formula | C28H42O5 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | 2-octoxycarbonylbenzoic acid;2-octylfuran |
| SMILES | CCCCCCCCOC(=O)c1ccccc1C(=O)O.CCCCCCCCc1ccco1 |
| InChI | InChI=1S/C16H22O4.C12H20O/c1-2-3-4-5-6-9-12-20-16(19)14-11-8-7-10-13(14)15(17)18;1-2-3-4-5-6-7-9-12-10-8-11-13-12/h7-8,10-11H,2-6,9,12H2,1H3,(H,17,18);8,10-11H,2-7,9H2,1H3 |
| InChIKey | XJLDELVOVNBYKG-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|