About 2-aminoacetic acid;(4-nitrophenyl)methylazanide;hydrochloride
2-aminoacetic acid;(4-nitrophenyl)methylazanide;hydrochloride (PubChem CID 131727693) has the molecular formula C9H13ClN3O4-
and a molecular weight of 262.67 g/mol. Its IUPAC name is 2-aminoacetic acid;(4-nitrophenyl)methylazanide;hydrochloride.
Molecular Properties
| Compound Name | 2-aminoacetic acid;(4-nitrophenyl)methylazanide;hydrochloride |
| PubChem CID | 131727693 |
| Molecular Formula | C9H13ClN3O4- |
| Molecular Weight | 262.67 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-aminoacetic acid;(4-nitrophenyl)methylazanide;hydrochloride |
| SMILES | Cl.NCC(=O)O.[NH-]Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C7H7N2O2.C2H5NO2.ClH/c8-5-6-1-3-7(4-2-6)9(10)11;3-1-2(4)5;/h1-4,8H,5H2;1,3H2,(H,4,5);1H/q-1;; |
| InChIKey | FOIYFGIHXAEMMH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 130.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.67 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoacetic acid;(4-nitrophenyl)methylazanide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;(4-nitrophenyl)methylazanide;hydrochloride?
The IUPAC name of 2-aminoacetic acid;(4-nitrophenyl)methylazanide;hydrochloride (CID 131727693) is 2-aminoacetic acid;(4-nitrophenyl)methylazanide;hydrochloride.
What is the SMILES notation for 2-aminoacetic acid;(4-nitrophenyl)methylazanide;hydrochloride?
The canonical SMILES for 2-aminoacetic acid;(4-nitrophenyl)methylazanide;hydrochloride is Cl.NCC(=O)O.[NH-]Cc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 2-aminoacetic acid;(4-nitrophenyl)methylazanide;hydrochloride?
The InChIKey is FOIYFGIHXAEMMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N2O2.C2H5NO2.ClH/c8-5-6-1-3-7(4-2-6)9(10)11;3-1-2(4)5;/h1-4,8H,5H2;1,3H2,(H,4,5);1H/q-1;;.
What are the key properties of 2-aminoacetic acid;(4-nitrophenyl)methylazanide;hydrochloride?
2-aminoacetic acid;(4-nitrophenyl)methylazanide;hydrochloride has a molecular weight of 262.67 g/mol, XLogP of 1.60, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;(4-nitrophenyl)methylazanide;hydrochloride is sourced from PubChem (CID 131727693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).