About (2S)-2-(methylamino)propanoic acid;(4-nitrophenyl)methylazanide;hydrochloride
(2S)-2-(methylamino)propanoic acid;(4-nitrophenyl)methylazanide;hydrochloride (PubChem CID 131739435) has the molecular formula C11H17ClN3O4-
and a molecular weight of 290.73 g/mol. Its IUPAC name is (2S)-2-(methylamino)propanoic acid;(4-nitrophenyl)methylazanide;hydrochloride.
Molecular Properties
| Compound Name | (2S)-2-(methylamino)propanoic acid;(4-nitrophenyl)methylazanide;hydrochloride |
| PubChem CID | 131739435 |
| Molecular Formula | C11H17ClN3O4- |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (2S)-2-(methylamino)propanoic acid;(4-nitrophenyl)methylazanide;hydrochloride |
| SMILES | CN[C@@H](C)C(=O)O.Cl.[NH-]Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C7H7N2O2.C4H9NO2.ClH/c8-5-6-1-3-7(4-2-6)9(10)11;1-3(5-2)4(6)7;/h1-4,8H,5H2;3,5H,1-2H3,(H,6,7);1H/q-1;;/t;3-;/m.0./s1 |
| InChIKey | CYUJQWQTIVMQCU-RJXKWAGSSA-N |
| XLogP | 2.25 |
| TPSA | 116.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(methylamino)propanoic acid;(4-nitrophenyl)methylazanide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(methylamino)propanoic acid;(4-nitrophenyl)methylazanide;hydrochloride?
The IUPAC name of (2S)-2-(methylamino)propanoic acid;(4-nitrophenyl)methylazanide;hydrochloride (CID 131739435) is (2S)-2-(methylamino)propanoic acid;(4-nitrophenyl)methylazanide;hydrochloride.
What is the SMILES notation for (2S)-2-(methylamino)propanoic acid;(4-nitrophenyl)methylazanide;hydrochloride?
The canonical SMILES for (2S)-2-(methylamino)propanoic acid;(4-nitrophenyl)methylazanide;hydrochloride is CN[C@@H](C)C(=O)O.Cl.[NH-]Cc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (2S)-2-(methylamino)propanoic acid;(4-nitrophenyl)methylazanide;hydrochloride?
The InChIKey is CYUJQWQTIVMQCU-RJXKWAGSSA-N. The full InChI is InChI=1S/C7H7N2O2.C4H9NO2.ClH/c8-5-6-1-3-7(4-2-6)9(10)11;1-3(5-2)4(6)7;/h1-4,8H,5H2;3,5H,1-2H3,(H,6,7);1H/q-1;;/t;3-;/m.0./s1.
What are the key properties of (2S)-2-(methylamino)propanoic acid;(4-nitrophenyl)methylazanide;hydrochloride?
(2S)-2-(methylamino)propanoic acid;(4-nitrophenyl)methylazanide;hydrochloride has a molecular weight of 290.73 g/mol, XLogP of 2.25, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(methylamino)propanoic acid;(4-nitrophenyl)methylazanide;hydrochloride is sourced from PubChem (CID 131739435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).