C17H29NO2 — CID 131728898
tert-butyl 2-[(1S,5R,6R)-6-(aminomethyl)-3-propan-2-yl-6-bicyclo[3.2.0]hept-3-enyl]acetate (PubChem CID 131728898) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is tert-butyl 2-[(1S,5R,6R)-6-(aminomethyl)-3-propan-2-yl-6-bicyclo[3.2.0]hept-3-enyl]acetate.
| Compound Name | tert-butyl 2-[(1S,5R,6R)-6-(aminomethyl)-3-propan-2-yl-6-bicyclo[3.2.0]hept-3-enyl]acetate |
|---|---|
| PubChem CID | 131728898 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | tert-butyl 2-[(1S,5R,6R)-6-(aminomethyl)-3-propan-2-yl-6-bicyclo[3.2.0]hept-3-enyl]acetate |
| SMILES | CC(C)C1=C[C@H]2[C@@H](C1)C[C@@]2(CN)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO2/c1-11(2)12-6-13-8-17(10-18,14(13)7-12)9-15(19)20-16(3,4)5/h7,11,13-14H,6,8-10,18H2,1-5H3/t13-,14-,17-/m0/s1 |
| InChIKey | ZOJVLSFYSCVZLM-ZQIUZPCESA-N |
| XLogP | 3.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|