C12H18FNO2 — CID 67199529
2-[(1S,5S,6S)-6-(aminomethyl)-3-(2-fluoroethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetic acid (PubChem CID 67199529) has the molecular formula C12H18FNO2 and a molecular weight of 227.28 g/mol. Its IUPAC name is 2-[(1S,5S,6S)-6-(aminomethyl)-3-(2-fluoroethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetic acid.
| Compound Name | 2-[(1S,5S,6S)-6-(aminomethyl)-3-(2-fluoroethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
|---|---|
| PubChem CID | 67199529 |
| Molecular Formula | C12H18FNO2 |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2-[(1S,5S,6S)-6-(aminomethyl)-3-(2-fluoroethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
| SMILES | NC[C@]1(CC(=O)O)C[C@@H]2CC(CCF)=C[C@H]21 |
| InChI | InChI=1S/C12H18FNO2/c13-2-1-8-3-9-5-12(7-14,6-11(15)16)10(9)4-8/h4,9-10H,1-3,5-7,14H2,(H,15,16)/t9-,10+,12+/m0/s1 |
| InChIKey | OEAYPDYMXLEMGL-HOSYDEDBSA-N |
| XLogP | 1.73 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|