C28H26N4O3S — CID 131731456
methyl (2S)-2-[5-[4-[(3-cyanophenyl)carbamothioylamino]phenyl]-3-oxo-1H-isoindol-2-yl]-3-methylbutanoate (PubChem CID 131731456) has the molecular formula C28H26N4O3S and a molecular weight of 498.61 g/mol. Its IUPAC name is methyl (2S)-2-[5-[4-[(3-cyanophenyl)carbamothioylamino]phenyl]-3-oxo-1H-isoindol-2-yl]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[5-[4-[(3-cyanophenyl)carbamothioylamino]phenyl]-3-oxo-1H-isoindol-2-yl]-3-methylbutanoate |
|---|---|
| PubChem CID | 131731456 |
| Molecular Formula | C28H26N4O3S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | methyl (2S)-2-[5-[4-[(3-cyanophenyl)carbamothioylamino]phenyl]-3-oxo-1H-isoindol-2-yl]-3-methylbutanoate |
| SMILES | COC(=O)[C@H](C(C)C)N1Cc2ccc(-c3ccc(NC(=S)Nc4cccc(C#N)c4)cc3)cc2C1=O |
| InChI | InChI=1S/C28H26N4O3S/c1-17(2)25(27(34)35-3)32-16-21-8-7-20(14-24(21)26(32)33)19-9-11-22(12-10-19)30-28(36)31-23-6-4-5-18(13-23)15-29/h4-14,17,25H,16H2,1-3H3,(H2,30,31,36)/t25-/m0/s1 |
| InChIKey | CWQZBJQUKXYVAS-VWLOTQADSA-N |
| XLogP | 5.19 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|