C12H17ClF2N2 — CID 131731751
1-[3-(1,1-difluoroethyl)phenyl]piperazine;hydrochloride (PubChem CID 131731751) has the molecular formula C12H17ClF2N2 and a molecular weight of 262.73 g/mol. Its IUPAC name is 1-[3-(1,1-difluoroethyl)phenyl]piperazine;hydrochloride.
| Compound Name | 1-[3-(1,1-difluoroethyl)phenyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 131731751 |
| Molecular Formula | C12H17ClF2N2 |
| Molecular Weight | 262.73 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 1-[3-(1,1-difluoroethyl)phenyl]piperazine;hydrochloride |
| SMILES | CC(F)(F)c1cccc(N2CCNCC2)c1.Cl |
| InChI | InChI=1S/C12H16F2N2.ClH/c1-12(13,14)10-3-2-4-11(9-10)16-7-5-15-6-8-16;/h2-4,9,15H,5-8H2,1H3;1H |
| InChIKey | ADHPWSZUKDJBES-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.73 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |