C12H16F3N3 — CID 66510325
(1R)-2,2,2-trifluoro-1-(3-piperazin-1-ylphenyl)ethanamine (PubChem CID 66510325) has the molecular formula C12H16F3N3 and a molecular weight of 259.28 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-(3-piperazin-1-ylphenyl)ethanamine.
| Compound Name | (1R)-2,2,2-trifluoro-1-(3-piperazin-1-ylphenyl)ethanamine |
|---|---|
| PubChem CID | 66510325 |
| Molecular Formula | C12H16F3N3 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-(3-piperazin-1-ylphenyl)ethanamine |
| SMILES | N[C@H](c1cccc(N2CCNCC2)c1)C(F)(F)F |
| InChI | InChI=1S/C12H16F3N3/c13-12(14,15)11(16)9-2-1-3-10(8-9)18-6-4-17-5-7-18/h1-3,8,11,17H,4-7,16H2/t11-/m1/s1 |
| InChIKey | BLTWRQQEZHGUQI-LLVKDONJSA-N |
| XLogP | 1.66 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |