About (1R)-2,2,2-trifluoro-1-(3-piperazin-1-ylphenyl)ethanamine
(1R)-2,2,2-trifluoro-1-(3-piperazin-1-ylphenyl)ethanamine (PubChem CID 66510325) has the molecular formula C12H16F3N3
and a molecular weight of 259.28 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-(3-piperazin-1-ylphenyl)ethanamine.
Molecular Properties
| Compound Name | (1R)-2,2,2-trifluoro-1-(3-piperazin-1-ylphenyl)ethanamine |
| PubChem CID | 66510325 |
| Molecular Formula | C12H16F3N3 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-(3-piperazin-1-ylphenyl)ethanamine |
| SMILES | N[C@H](c1cccc(N2CCNCC2)c1)C(F)(F)F |
| InChI | InChI=1S/C12H16F3N3/c13-12(14,15)11(16)9-2-1-3-10(8-9)18-6-4-17-5-7-18/h1-3,8,11,17H,4-7,16H2/t11-/m1/s1 |
| InChIKey | BLTWRQQEZHGUQI-LLVKDONJSA-N |
| XLogP | 1.66 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-2,2,2-trifluoro-1-(3-piperazin-1-ylphenyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2,2,2-trifluoro-1-(3-piperazin-1-ylphenyl)ethanamine?
The IUPAC name of (1R)-2,2,2-trifluoro-1-(3-piperazin-1-ylphenyl)ethanamine (CID 66510325) is (1R)-2,2,2-trifluoro-1-(3-piperazin-1-ylphenyl)ethanamine.
What is the SMILES notation for (1R)-2,2,2-trifluoro-1-(3-piperazin-1-ylphenyl)ethanamine?
The canonical SMILES for (1R)-2,2,2-trifluoro-1-(3-piperazin-1-ylphenyl)ethanamine is N[C@H](c1cccc(N2CCNCC2)c1)C(F)(F)F.
What is the InChIKey of (1R)-2,2,2-trifluoro-1-(3-piperazin-1-ylphenyl)ethanamine?
The InChIKey is BLTWRQQEZHGUQI-LLVKDONJSA-N. The full InChI is InChI=1S/C12H16F3N3/c13-12(14,15)11(16)9-2-1-3-10(8-9)18-6-4-17-5-7-18/h1-3,8,11,17H,4-7,16H2/t11-/m1/s1.
What are the key properties of (1R)-2,2,2-trifluoro-1-(3-piperazin-1-ylphenyl)ethanamine?
(1R)-2,2,2-trifluoro-1-(3-piperazin-1-ylphenyl)ethanamine has a molecular weight of 259.28 g/mol, XLogP of 1.66, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2,2,2-trifluoro-1-(3-piperazin-1-ylphenyl)ethanamine is sourced from PubChem (CID 66510325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).