C24H26ClN3O4 — CID 131733288
tert-butyl N-[2-[[7-[(3-chlorophenyl)methoxy]quinoline-3-carbonyl]amino]ethyl]carbamate (PubChem CID 131733288) has the molecular formula C24H26ClN3O4 and a molecular weight of 455.94 g/mol. Its IUPAC name is tert-butyl N-[2-[[7-[(3-chlorophenyl)methoxy]quinoline-3-carbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[7-[(3-chlorophenyl)methoxy]quinoline-3-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 131733288 |
| Molecular Formula | C24H26ClN3O4 |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | tert-butyl N-[2-[[7-[(3-chlorophenyl)methoxy]quinoline-3-carbonyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)c1cnc2cc(OCc3cccc(Cl)c3)ccc2c1 |
| InChI | InChI=1S/C24H26ClN3O4/c1-24(2,3)32-23(30)27-10-9-26-22(29)18-12-17-7-8-20(13-21(17)28-14-18)31-15-16-5-4-6-19(25)11-16/h4-8,11-14H,9-10,15H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | FPLRWJSNWXTLMU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|