C13H19IN4O3 — CID 131734891
butyl 3-carbamoyl-2-iodo-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate (PubChem CID 131734891) has the molecular formula C13H19IN4O3 and a molecular weight of 406.22 g/mol. Its IUPAC name is butyl 3-carbamoyl-2-iodo-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate.
| Compound Name | butyl 3-carbamoyl-2-iodo-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
|---|---|
| PubChem CID | 131734891 |
| Molecular Formula | C13H19IN4O3 |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | butyl 3-carbamoyl-2-iodo-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
| SMILES | CCCCOC(=O)N1Cc2c(C(N)=O)c(I)nn2CC1C |
| InChI | InChI=1S/C13H19IN4O3/c1-3-4-5-21-13(20)17-7-9-10(12(15)19)11(14)16-18(9)6-8(17)2/h8H,3-7H2,1-2H3,(H2,15,19) |
| InChIKey | KAVHLAKOFYPSIE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|