C22H34N2O6 — CID 98541936
butyl (Z)-4-[(2S,5S)-4-[(Z)-4-butoxy-4-oxobut-2-enoyl]-2,5-dimethylpiperazin-1-yl]-4-oxobut-2-enoate (PubChem CID 98541936) has the molecular formula C22H34N2O6 and a molecular weight of 422.52 g/mol. Its IUPAC name is butyl (Z)-4-[(2S,5S)-4-[(Z)-4-butoxy-4-oxobut-2-enoyl]-2,5-dimethylpiperazin-1-yl]-4-oxobut-2-enoate.
| Compound Name | butyl (Z)-4-[(2S,5S)-4-[(Z)-4-butoxy-4-oxobut-2-enoyl]-2,5-dimethylpiperazin-1-yl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 98541936 |
| Molecular Formula | C22H34N2O6 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | butyl (Z)-4-[(2S,5S)-4-[(Z)-4-butoxy-4-oxobut-2-enoyl]-2,5-dimethylpiperazin-1-yl]-4-oxobut-2-enoate |
| SMILES | CCCCOC(=O)/C=C\C(=O)N1C[C@H](C)N(C(=O)/C=C\C(=O)OCCCC)C[C@@H]1C |
| InChI | InChI=1S/C22H34N2O6/c1-5-7-13-29-21(27)11-9-19(25)23-15-18(4)24(16-17(23)3)20(26)10-12-22(28)30-14-8-6-2/h9-12,17-18H,5-8,13-16H2,1-4H3/b11-9-,12-10-/t17-,18-/m0/s1 |
| InChIKey | MOKPUXYDMNIIEJ-AKVIFYCRSA-N |
| XLogP | 2.23 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|