C20H30N2O6 — CID 98541922
propyl (Z)-4-[(2S,5S)-2,5-dimethyl-4-[(Z)-4-oxo-4-propoxybut-2-enoyl]piperazin-1-yl]-4-oxobut-2-enoate (PubChem CID 98541922) has the molecular formula C20H30N2O6 and a molecular weight of 394.47 g/mol. Its IUPAC name is propyl (Z)-4-[(2S,5S)-2,5-dimethyl-4-[(Z)-4-oxo-4-propoxybut-2-enoyl]piperazin-1-yl]-4-oxobut-2-enoate.
| Compound Name | propyl (Z)-4-[(2S,5S)-2,5-dimethyl-4-[(Z)-4-oxo-4-propoxybut-2-enoyl]piperazin-1-yl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 98541922 |
| Molecular Formula | C20H30N2O6 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | propyl (Z)-4-[(2S,5S)-2,5-dimethyl-4-[(Z)-4-oxo-4-propoxybut-2-enoyl]piperazin-1-yl]-4-oxobut-2-enoate |
| SMILES | CCCOC(=O)/C=C\C(=O)N1C[C@H](C)N(C(=O)/C=C\C(=O)OCCC)C[C@@H]1C |
| InChI | InChI=1S/C20H30N2O6/c1-5-11-27-19(25)9-7-17(23)21-13-16(4)22(14-15(21)3)18(24)8-10-20(26)28-12-6-2/h7-10,15-16H,5-6,11-14H2,1-4H3/b9-7-,10-8-/t15-,16-/m0/s1 |
| InChIKey | FEGBEVVXIMRMSX-FQZKODOSSA-N |
| XLogP | 1.45 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|