About propyl 3-aminoprop-2-enoate
propyl 3-aminoprop-2-enoate (PubChem CID 154061664) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is propyl 3-aminoprop-2-enoate.
Molecular Properties
| Compound Name | propyl 3-aminoprop-2-enoate |
| PubChem CID | 154061664 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | propyl 3-aminoprop-2-enoate |
| SMILES | CCCOC(=O)C=CN |
| InChI | InChI=1S/C6H11NO2/c1-2-5-9-6(8)3-4-7/h3-4H,2,5,7H2,1H3 |
| InChIKey | RHZUCBDJZVSUPD-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze propyl 3-aminoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 3-aminoprop-2-enoate?
The IUPAC name of propyl 3-aminoprop-2-enoate (CID 154061664) is propyl 3-aminoprop-2-enoate.
What is the SMILES notation for propyl 3-aminoprop-2-enoate?
The canonical SMILES for propyl 3-aminoprop-2-enoate is CCCOC(=O)C=CN.
What is the InChIKey of propyl 3-aminoprop-2-enoate?
The InChIKey is RHZUCBDJZVSUPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c1-2-5-9-6(8)3-4-7/h3-4H,2,5,7H2,1H3.
What are the key properties of propyl 3-aminoprop-2-enoate?
propyl 3-aminoprop-2-enoate has a molecular weight of 129.16 g/mol, XLogP of 0.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 3-aminoprop-2-enoate is sourced from PubChem (CID 154061664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).