About pentyl (E)-3-aminoprop-2-enoate
pentyl (E)-3-aminoprop-2-enoate (PubChem CID 89288114) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is pentyl (E)-3-aminoprop-2-enoate.
Molecular Properties
| Compound Name | pentyl (E)-3-aminoprop-2-enoate |
| PubChem CID | 89288114 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | pentyl (E)-3-aminoprop-2-enoate |
| SMILES | CCCCCOC(=O)/C=C/N |
| InChI | InChI=1S/C8H15NO2/c1-2-3-4-7-11-8(10)5-6-9/h5-6H,2-4,7,9H2,1H3/b6-5+ |
| InChIKey | CYCCFGLYDLLZJD-AATRIKPKSA-N |
| XLogP | 1.19 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze pentyl (E)-3-aminoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl (E)-3-aminoprop-2-enoate?
The IUPAC name of pentyl (E)-3-aminoprop-2-enoate (CID 89288114) is pentyl (E)-3-aminoprop-2-enoate.
What is the SMILES notation for pentyl (E)-3-aminoprop-2-enoate?
The canonical SMILES for pentyl (E)-3-aminoprop-2-enoate is CCCCCOC(=O)/C=C/N.
What is the InChIKey of pentyl (E)-3-aminoprop-2-enoate?
The InChIKey is CYCCFGLYDLLZJD-AATRIKPKSA-N. The full InChI is InChI=1S/C8H15NO2/c1-2-3-4-7-11-8(10)5-6-9/h5-6H,2-4,7,9H2,1H3/b6-5+.
What are the key properties of pentyl (E)-3-aminoprop-2-enoate?
pentyl (E)-3-aminoprop-2-enoate has a molecular weight of 157.21 g/mol, XLogP of 1.19, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl (E)-3-aminoprop-2-enoate is sourced from PubChem (CID 89288114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).