C10H4F4N2O — CID 131735128
4-(2,3,5,6-tetrafluorophenoxy)pyrimidine (PubChem CID 131735128) has the molecular formula C10H4F4N2O and a molecular weight of 244.15 g/mol. Its IUPAC name is 4-(2,3,5,6-tetrafluorophenoxy)pyrimidine.
| Compound Name | 4-(2,3,5,6-tetrafluorophenoxy)pyrimidine |
|---|---|
| PubChem CID | 131735128 |
| Molecular Formula | C10H4F4N2O |
| Molecular Weight | 244.15 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 4-(2,3,5,6-tetrafluorophenoxy)pyrimidine |
| SMILES | Fc1cc(F)c(F)c(Oc2ccncn2)c1F |
| InChI | InChI=1S/C10H4F4N2O/c11-5-3-6(12)9(14)10(8(5)13)17-7-1-2-15-4-16-7/h1-4H |
| InChIKey | XMPZICVIXAFICH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.15 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|