C23H34Cl2FNO3 — CID 131736474
1,3-dichloropropan-2-yl carbamate;(8R,9S,10R,13S,14S,16R)-16-fluoro-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 131736474) has the molecular formula C23H34Cl2FNO3 and a molecular weight of 462.43 g/mol. Its IUPAC name is 1,3-dichloropropan-2-yl carbamate;(8R,9S,10R,13S,14S,16R)-16-fluoro-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | 1,3-dichloropropan-2-yl carbamate;(8R,9S,10R,13S,14S,16R)-16-fluoro-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 131736474 |
| Molecular Formula | C23H34Cl2FNO3 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 1,3-dichloropropan-2-yl carbamate;(8R,9S,10R,13S,14S,16R)-16-fluoro-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCCCC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)[C@H](F)C[C@@H]12.NC(=O)OC(CCl)CCl |
| InChI | InChI=1S/C19H27FO.C4H7Cl2NO2/c1-18-9-4-3-5-12(18)6-7-13-14(18)8-10-19(2)15(13)11-16(20)17(19)21;5-1-3(2-6)9-4(7)8/h6,13-16H,3-5,7-11H2,1-2H3;3H,1-2H2,(H2,7,8)/t13-,14+,15+,16-,18+,19+;/m1./s1 |
| InChIKey | QRTGRKYPWUZCIK-XQBLSDRJSA-N |
| XLogP | 5.78 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|