C18H27N3O3 — CID 131736801
N-tert-butyl-1-[(3-methyl-5-nitrophenyl)methyl]piperidine-4-carboxamide (PubChem CID 131736801) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is N-tert-butyl-1-[(3-methyl-5-nitrophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-tert-butyl-1-[(3-methyl-5-nitrophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 131736801 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | N-tert-butyl-1-[(3-methyl-5-nitrophenyl)methyl]piperidine-4-carboxamide |
| SMILES | Cc1cc(CN2CCC(C(=O)NC(C)(C)C)CC2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H27N3O3/c1-13-9-14(11-16(10-13)21(23)24)12-20-7-5-15(6-8-20)17(22)19-18(2,3)4/h9-11,15H,5-8,12H2,1-4H3,(H,19,22) |
| InChIKey | YIXNLZVMVAKDNC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|