C38H36F2O4S — CID 131737015
3-(adamantane-1-carbonyloxy)-2,2-difluoro-3-phenylpropanoate;triphenylsulfanium (PubChem CID 131737015) has the molecular formula C38H36F2O4S and a molecular weight of 626.77 g/mol. Its IUPAC name is 3-(adamantane-1-carbonyloxy)-2,2-difluoro-3-phenylpropanoate;triphenylsulfanium.
| Compound Name | 3-(adamantane-1-carbonyloxy)-2,2-difluoro-3-phenylpropanoate;triphenylsulfanium |
|---|---|
| PubChem CID | 131737015 |
| Molecular Formula | C38H36F2O4S |
| Molecular Weight | 626.77 g/mol |
| Exact Mass | 626.23 |
| IUPAC Name | 3-(adamantane-1-carbonyloxy)-2,2-difluoro-3-phenylpropanoate;triphenylsulfanium |
| SMILES | O=C(OC(c1ccccc1)C(F)(F)C(=O)[O-])C12CC3CC(CC(C3)C1)C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H22F2O4.C18H15S/c21-20(22,17(23)24)16(15-4-2-1-3-5-15)26-18(25)19-9-12-6-13(10-19)8-14(7-12)11-19;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-5,12-14,16H,6-11H2,(H,23,24);1-15H/q;+1/p-1 |
| InChIKey | KCHBMEXHNBKHGO-UHFFFAOYSA-M |
| XLogP | 7.65 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.77 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|