C26H30NO9P — CID 131738669
[(8S)-8-acetamido-13,14,15-trimethoxy-5-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl] dihydrogen phosphate;phenol (PubChem CID 131738669) has the molecular formula C26H30NO9P and a molecular weight of 531.50 g/mol. Its IUPAC name is [(8S)-8-acetamido-13,14,15-trimethoxy-5-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl] dihydrogen phosphate;phenol.
| Compound Name | [(8S)-8-acetamido-13,14,15-trimethoxy-5-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl] dihydrogen phosphate;phenol |
|---|---|
| PubChem CID | 131738669 |
| Molecular Formula | C26H30NO9P |
| Molecular Weight | 531.50 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | [(8S)-8-acetamido-13,14,15-trimethoxy-5-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl] dihydrogen phosphate;phenol |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(OP(=O)(O)O)cc1[C@@H](NC(C)=O)CC2.Oc1ccccc1 |
| InChI | InChI=1S/C20H24NO8P.C6H6O/c1-11(22)21-16-8-5-12-9-17(26-2)19(27-3)20(28-4)18(12)14-7-6-13(10-15(14)16)29-30(23,24)25;7-6-4-2-1-3-5-6/h6-7,9-10,16H,5,8H2,1-4H3,(H,21,22)(H2,23,24,25);1-5,7H/t16-;/m0./s1 |
| InChIKey | QNMIZZVGINXURN-NTISSMGPSA-N |
| XLogP | 4.37 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|