C33H33Cl2F4NO4 — CID 131740258
butyl 3-[[4-[1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-2-(4-chlorophenyl)-1-oxohexan-3-yl]benzoyl]amino]propanoate (PubChem CID 131740258) has the molecular formula C33H33Cl2F4NO4 and a molecular weight of 654.53 g/mol. Its IUPAC name is butyl 3-[[4-[1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-2-(4-chlorophenyl)-1-oxohexan-3-yl]benzoyl]amino]propanoate.
| Compound Name | butyl 3-[[4-[1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-2-(4-chlorophenyl)-1-oxohexan-3-yl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 131740258 |
| Molecular Formula | C33H33Cl2F4NO4 |
| Molecular Weight | 654.53 g/mol |
| Exact Mass | 653.17 |
| IUPAC Name | butyl 3-[[4-[1-[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]-2-(4-chlorophenyl)-1-oxohexan-3-yl]benzoyl]amino]propanoate |
| SMILES | CCCCOC(=O)CCNC(=O)c1ccc(C(CCC)C(C(=O)c2cc(C(F)(F)F)cc(Cl)c2F)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C33H33Cl2F4NO4/c1-3-5-17-44-28(41)15-16-40-32(43)22-9-7-20(8-10-22)25(6-4-2)29(21-11-13-24(34)14-12-21)31(42)26-18-23(33(37,38)39)19-27(35)30(26)36/h7-14,18-19,25,29H,3-6,15-17H2,1-2H3,(H,40,43) |
| InChIKey | AUPFEEHNLJGIOG-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.53 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|