C19H28BrN3O2Si — CID 131743508
N-(3-bromo-5-methylphenyl)-4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]pyrimidin-2-amine (PubChem CID 131743508) has the molecular formula C19H28BrN3O2Si and a molecular weight of 438.44 g/mol. Its IUPAC name is N-(3-bromo-5-methylphenyl)-4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]pyrimidin-2-amine.
| Compound Name | N-(3-bromo-5-methylphenyl)-4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]pyrimidin-2-amine |
|---|---|
| PubChem CID | 131743508 |
| Molecular Formula | C19H28BrN3O2Si |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | N-(3-bromo-5-methylphenyl)-4-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]pyrimidin-2-amine |
| SMILES | Cc1cc(Br)cc(Nc2nccc(OCCO[Si](C)(C)C(C)(C)C)n2)c1 |
| InChI | InChI=1S/C19H28BrN3O2Si/c1-14-11-15(20)13-16(12-14)22-18-21-8-7-17(23-18)24-9-10-25-26(5,6)19(2,3)4/h7-8,11-13H,9-10H2,1-6H3,(H,21,22,23) |
| InChIKey | GRQJXEAWCGTZPY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|