C18H28N4O2Si — CID 131743808
(2R,3S,5R)-5-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3-[tert-butyl(dimethyl)silyl]oxolane-2-carbaldehyde (PubChem CID 131743808) has the molecular formula C18H28N4O2Si and a molecular weight of 360.53 g/mol. Its IUPAC name is (2R,3S,5R)-5-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3-[tert-butyl(dimethyl)silyl]oxolane-2-carbaldehyde.
| Compound Name | (2R,3S,5R)-5-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3-[tert-butyl(dimethyl)silyl]oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 131743808 |
| Molecular Formula | C18H28N4O2Si |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (2R,3S,5R)-5-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3-[tert-butyl(dimethyl)silyl]oxolane-2-carbaldehyde |
| SMILES | Cc1cn([C@H]2C[C@H]([Si](C)(C)C(C)(C)C)[C@@H](C=O)O2)c2ncnc(N)c12 |
| InChI | InChI=1S/C18H28N4O2Si/c1-11-8-22(17-15(11)16(19)20-10-21-17)14-7-13(12(9-23)24-14)25(5,6)18(2,3)4/h8-10,12-14H,7H2,1-6H3,(H2,19,20,21)/t12-,13+,14-/m1/s1 |
| InChIKey | MHAVZCYWUPPKOZ-HZSPNIEDSA-N |
| XLogP | 3.69 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|