C19H20N4O3S — CID 131745837
butyl 2-[[2-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]-3-pyridinyl]oxy]acetate (PubChem CID 131745837) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is butyl 2-[[2-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]-3-pyridinyl]oxy]acetate.
| Compound Name | butyl 2-[[2-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]-3-pyridinyl]oxy]acetate |
|---|---|
| PubChem CID | 131745837 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | butyl 2-[[2-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]-3-pyridinyl]oxy]acetate |
| SMILES | CCCCOC(=O)COc1cccnc1Nc1nc(-c2ccccn2)cs1 |
| InChI | InChI=1S/C19H20N4O3S/c1-2-3-11-25-17(24)12-26-16-8-6-10-21-18(16)23-19-22-15(13-27-19)14-7-4-5-9-20-14/h4-10,13H,2-3,11-12H2,1H3,(H,21,22,23) |
| InChIKey | MJRGLXGXOKHYFZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|