C17H15N4O2- — CID 131746946
4-[[(1-methylpyrazol-3-yl)-pyridin-2-ylamino]methyl]benzoate (PubChem CID 131746946) has the molecular formula C17H15N4O2- and a molecular weight of 307.33 g/mol. Its IUPAC name is 4-[[(1-methylpyrazol-3-yl)-pyridin-2-ylamino]methyl]benzoate.
| Compound Name | 4-[[(1-methylpyrazol-3-yl)-pyridin-2-ylamino]methyl]benzoate |
|---|---|
| PubChem CID | 131746946 |
| Molecular Formula | C17H15N4O2- |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 4-[[(1-methylpyrazol-3-yl)-pyridin-2-ylamino]methyl]benzoate |
| SMILES | Cn1ccc(N(Cc2ccc(C(=O)[O-])cc2)c2ccccn2)n1 |
| InChI | InChI=1S/C17H16N4O2/c1-20-11-9-16(19-20)21(15-4-2-3-10-18-15)12-13-5-7-14(8-6-13)17(22)23/h2-11H,12H2,1H3,(H,22,23)/p-1 |
| InChIKey | RBDAKDOAWALKFU-UHFFFAOYSA-M |
| XLogP | 1.52 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |