C19H22IN5O3 — CID 170095440
[[4-[[(4-methylpiperazine-1-carbonyl)-pyridin-2-ylamino]methyl]benzoyl]amino] hypoiodite (PubChem CID 170095440) has the molecular formula C19H22IN5O3 and a molecular weight of 495.32 g/mol. Its IUPAC name is [[4-[[(4-methylpiperazine-1-carbonyl)-pyridin-2-ylamino]methyl]benzoyl]amino] hypoiodite.
| Compound Name | [[4-[[(4-methylpiperazine-1-carbonyl)-pyridin-2-ylamino]methyl]benzoyl]amino] hypoiodite |
|---|---|
| PubChem CID | 170095440 |
| Molecular Formula | C19H22IN5O3 |
| Molecular Weight | 495.32 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | [[4-[[(4-methylpiperazine-1-carbonyl)-pyridin-2-ylamino]methyl]benzoyl]amino] hypoiodite |
| SMILES | CN1CCN(C(=O)N(Cc2ccc(C(=O)NOI)cc2)c2ccccn2)CC1 |
| InChI | InChI=1S/C19H22IN5O3/c1-23-10-12-24(13-11-23)19(27)25(17-4-2-3-9-21-17)14-15-5-7-16(8-6-15)18(26)22-28-20/h2-9H,10-14H2,1H3,(H,22,26) |
| InChIKey | GAYZJNLKAVLQLU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|