C20H24IN5O3 — CID 170097038
4-ethyl-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-N-(6-iodo-2-pyridinyl)piperazine-1-carboxamide (PubChem CID 170097038) has the molecular formula C20H24IN5O3 and a molecular weight of 509.35 g/mol. Its IUPAC name is 4-ethyl-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-N-(6-iodo-2-pyridinyl)piperazine-1-carboxamide.
| Compound Name | 4-ethyl-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-N-(6-iodo-2-pyridinyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 170097038 |
| Molecular Formula | C20H24IN5O3 |
| Molecular Weight | 509.35 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 4-ethyl-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-N-(6-iodo-2-pyridinyl)piperazine-1-carboxamide |
| SMILES | CCN1CCN(C(=O)N(Cc2ccc(C(=O)NO)cc2)c2cccc(I)n2)CC1 |
| InChI | InChI=1S/C20H24IN5O3/c1-2-24-10-12-25(13-11-24)20(28)26(18-5-3-4-17(21)22-18)14-15-6-8-16(9-7-15)19(27)23-29/h3-9,29H,2,10-14H2,1H3,(H,23,27) |
| InChIKey | MNVXGRFOYXAMLG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|