C7H12NO3- — CID 131747487
3-(methoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 131747487) has the molecular formula C7H12NO3- and a molecular weight of 158.18 g/mol. Its IUPAC name is 3-(methoxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | 3-(methoxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 131747487 |
| Molecular Formula | C7H12NO3- |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 3-(methoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | COCC1CCN(C(=O)[O-])C1 |
| InChI | InChI=1S/C7H13NO3/c1-11-5-6-2-3-8(4-6)7(9)10/h6H,2-5H2,1H3,(H,9,10)/p-1 |
| InChIKey | VNYXEDRXVSDRLZ-UHFFFAOYSA-M |
| XLogP | -0.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |