C11H22N2O2 — CID 115642604
N,N-diethyl-3-(methoxymethyl)pyrrolidine-1-carboxamide (PubChem CID 115642604) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is N,N-diethyl-3-(methoxymethyl)pyrrolidine-1-carboxamide.
| Compound Name | N,N-diethyl-3-(methoxymethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 115642604 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | N,N-diethyl-3-(methoxymethyl)pyrrolidine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCC(COC)C1 |
| InChI | InChI=1S/C11H22N2O2/c1-4-12(5-2)11(14)13-7-6-10(8-13)9-15-3/h10H,4-9H2,1-3H3 |
| InChIKey | BIFHFFSGGLZWNV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |