C11H22N2O2 — CID 103896864
N,N-diethyl-3-hydroxy-4-methylpiperidine-1-carboxamide (PubChem CID 103896864) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is N,N-diethyl-3-hydroxy-4-methylpiperidine-1-carboxamide.
| Compound Name | N,N-diethyl-3-hydroxy-4-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 103896864 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | N,N-diethyl-3-hydroxy-4-methylpiperidine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCC(C)C(O)C1 |
| InChI | InChI=1S/C11H22N2O2/c1-4-12(5-2)11(15)13-7-6-9(3)10(14)8-13/h9-10,14H,4-8H2,1-3H3 |
| InChIKey | AVJNUCZZNAQITL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |