C14H17F2NO5 — CID 131747725
(2R)-2-(2,5-difluorophenyl)pyrrolidine;(2R)-2-hydroxybutanedioic acid (PubChem CID 131747725) has the molecular formula C14H17F2NO5 and a molecular weight of 317.29 g/mol. Its IUPAC name is (2R)-2-(2,5-difluorophenyl)pyrrolidine;(2R)-2-hydroxybutanedioic acid.
| Compound Name | (2R)-2-(2,5-difluorophenyl)pyrrolidine;(2R)-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 131747725 |
| Molecular Formula | C14H17F2NO5 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | (2R)-2-(2,5-difluorophenyl)pyrrolidine;(2R)-2-hydroxybutanedioic acid |
| SMILES | Fc1ccc(F)c([C@H]2CCCN2)c1.O=C(O)C[C@@H](O)C(=O)O |
| InChI | InChI=1S/C10H11F2N.C4H6O5/c11-7-3-4-9(12)8(6-7)10-2-1-5-13-10;5-2(4(8)9)1-3(6)7/h3-4,6,10,13H,1-2,5H2;2,5H,1H2,(H,6,7)(H,8,9)/t10-;2-/m11/s1 |
| InChIKey | KMLXGOHWKMHXAE-SBHYBIRFSA-N |
| XLogP | 1.30 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |