C10H18O3 — CID 131752432
(Z)-6-methyl-2-methylideneoct-6-ene-1,3,8-triol (PubChem CID 131752432) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (Z)-6-methyl-2-methylideneoct-6-ene-1,3,8-triol.
| Compound Name | (Z)-6-methyl-2-methylideneoct-6-ene-1,3,8-triol |
|---|---|
| PubChem CID | 131752432 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (Z)-6-methyl-2-methylideneoct-6-ene-1,3,8-triol |
| SMILES | C=C(CO)C(O)CC/C(C)=C\CO |
| InChI | InChI=1S/C10H18O3/c1-8(5-6-11)3-4-10(13)9(2)7-12/h5,10-13H,2-4,6-7H2,1H3/b8-5- |
| InChIKey | KSMRZTSAPKWVGY-YVMONPNESA-N |
| XLogP | 0.61 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|