C21H20O4 — CID 131752689
(2Z,7E)-1,9-bis(4-hydroxyphenyl)nona-2,7-diene-4,6-dione (PubChem CID 131752689) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is (2Z,7E)-1,9-bis(4-hydroxyphenyl)nona-2,7-diene-4,6-dione.
| Compound Name | (2Z,7E)-1,9-bis(4-hydroxyphenyl)nona-2,7-diene-4,6-dione |
|---|---|
| PubChem CID | 131752689 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (2Z,7E)-1,9-bis(4-hydroxyphenyl)nona-2,7-diene-4,6-dione |
| SMILES | O=C(/C=C\Cc1ccc(O)cc1)CC(=O)/C=C/Cc1ccc(O)cc1 |
| InChI | InChI=1S/C21H20O4/c22-18-11-7-16(8-12-18)3-1-5-20(24)15-21(25)6-2-4-17-9-13-19(23)14-10-17/h1-2,5-14,22-23H,3-4,15H2/b5-1-,6-2+ |
| InChIKey | YIKBSQXTKGFYHB-SOSXVSKCSA-N |
| XLogP | 3.52 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|