C17H22O8 — CID 131752941
methyl (Z)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxydec-8-en-4,6-diynoate (PubChem CID 131752941) has the molecular formula C17H22O8 and a molecular weight of 354.36 g/mol. Its IUPAC name is methyl (Z)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxydec-8-en-4,6-diynoate.
| Compound Name | methyl (Z)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxydec-8-en-4,6-diynoate |
|---|---|
| PubChem CID | 131752941 |
| Molecular Formula | C17H22O8 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | methyl (Z)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxydec-8-en-4,6-diynoate |
| SMILES | COC(=O)CCC#CC#C/C=C\COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C17H22O8/c1-23-13(19)9-7-5-3-2-4-6-8-10-24-17-16(22)15(21)14(20)12(11-18)25-17/h6,8,12,14-18,20-22H,7,9-11H2,1H3/b8-6- |
| InChIKey | KMCLOJYUKASTFN-VURMDHGXSA-N |
| XLogP | -1.68 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|