C10H18O7S — CID 154497810
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(E)-3-[(R)-methylsulfinyl]prop-2-enoxy]oxane-3,4,5-triol (PubChem CID 154497810) has the molecular formula C10H18O7S and a molecular weight of 282.31 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(E)-3-[(R)-methylsulfinyl]prop-2-enoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(E)-3-[(R)-methylsulfinyl]prop-2-enoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 154497810 |
| Molecular Formula | C10H18O7S |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(E)-3-[(R)-methylsulfinyl]prop-2-enoxy]oxane-3,4,5-triol |
| SMILES | C[S@@](=O)/C=C/CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18O7S/c1-18(15)4-2-3-16-10-9(14)8(13)7(12)6(5-11)17-10/h2,4,6-14H,3,5H2,1H3/b4-2+/t6-,7-,8+,9-,10-,18-/m1/s1 |
| InChIKey | BODMIDYRRVYSOA-YXDBKNJJSA-N |
| XLogP | -2.30 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |