C15H33N3O2+2 — CID 13177837
[3-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]-2-hydroxypropyl]-trimethylazanium (PubChem CID 13177837) has the molecular formula C15H33N3O2+2 and a molecular weight of 287.45 g/mol. Its IUPAC name is [3-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]-2-hydroxypropyl]-trimethylazanium.
| Compound Name | [3-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]-2-hydroxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 13177837 |
| Molecular Formula | C15H33N3O2+2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | [3-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]-2-hydroxypropyl]-trimethylazanium |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C)CC(O)C[N+](C)(C)C |
| InChI | InChI=1S/C15H32N3O2/c1-13(2)15(20)16-9-8-10-18(6,7)12-14(19)11-17(3,4)5/h14,19H,1,8-12H2,2-7H3/q+1/p+1 |
| InChIKey | BGPBCXAWPKVVLS-UHFFFAOYSA-O |
| XLogP | 0.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|