C32H39N3 — CID 13179623
6-[(4-benzhydrylpiperazin-1-yl)methyl]-N,N-diethyl-7,8-dihydronaphthalen-2-amine (PubChem CID 13179623) has the molecular formula C32H39N3 and a molecular weight of 465.69 g/mol. Its IUPAC name is 6-[(4-benzhydrylpiperazin-1-yl)methyl]-N,N-diethyl-7,8-dihydronaphthalen-2-amine.
| Compound Name | 6-[(4-benzhydrylpiperazin-1-yl)methyl]-N,N-diethyl-7,8-dihydronaphthalen-2-amine |
|---|---|
| PubChem CID | 13179623 |
| Molecular Formula | C32H39N3 |
| Molecular Weight | 465.69 g/mol |
| Exact Mass | 465.31 |
| IUPAC Name | 6-[(4-benzhydrylpiperazin-1-yl)methyl]-N,N-diethyl-7,8-dihydronaphthalen-2-amine |
| SMILES | CCN(CC)c1ccc2c(c1)CCC(CN1CCN(C(c3ccccc3)c3ccccc3)CC1)=C2 |
| InChI | InChI=1S/C32H39N3/c1-3-34(4-2)31-18-17-29-23-26(15-16-30(29)24-31)25-33-19-21-35(22-20-33)32(27-11-7-5-8-12-27)28-13-9-6-10-14-28/h5-14,17-18,23-24,32H,3-4,15-16,19-22,25H2,1-2H3 |
| InChIKey | UBGFNTFPDYMVMU-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.69 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|